CAS 453562-01-1 appears in our catalog under these names: 1-Methyl-4-((3-nitrophenyl)sulfonyl)piperazine, 98%, 1-Methyl-4-(3-nitro-benzenesulfonyl)-piperazine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 1g, 5g.
1-methyl-4-(3-nitrophenyl)sulfonylpiperazine (CAS 453562-01-1) is a chemical compound with the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. IUPAC name: 1-methyl-4-(3-nitrophenyl)sulfonylpiperazine. InChIKey: DIVBSLFLEUQVSP-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O4S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | 1-methyl-4-(3-nitrophenyl)sulfonylpiperazine |
| InChIKey | DIVBSLFLEUQVSP-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)