Products 1354960-36-3
CAS 1354960-36-3 appears in our catalog under these names: 1-(4-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl)ethan-1-amine dihydrochloride, 95%, 1-(4-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethanamine;dihydrochloride (CAS 1354960-36-3) is a chemical compound with the molecular formula C13H19Cl2N3 and a molecular weight of 288.21 g/mol. IUPAC name: 1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethanamine;dihydrochloride. InChIKey: RZCKILNBMOYCLL-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2N3 |
|---|---|
| Molecular weight | 288.21 g/mol |
| IUPAC name | 1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethanamine;dihydrochloride |
| InChIKey | RZCKILNBMOYCLL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)C(C)N)C.Cl.Cl |
Computed by PubChem (NCBI)