Products 1158371-88-0

CAS 1158371-88-0 is the registry number for N-(4-Bromobenzyl)cyclohexanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

N-[(4-bromophenyl)methyl]cyclohexanamine;hydrochloride (CAS 1158371-88-0) is a chemical compound with the molecular formula C13H19BrClN and a molecular weight of 304.65 g/mol. IUPAC name: N-[(4-bromophenyl)methyl]cyclohexanamine;hydrochloride. InChIKey: RBWGDOOIQMPBDU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19BrClN
Molecular weight304.65 g/mol
IUPAC nameN-[(4-bromophenyl)methyl]cyclohexanamine;hydrochloride
InChIKeyRBWGDOOIQMPBDU-UHFFFAOYSA-N
SMILESC1CCC(CC1)NCC2=CC=C(C=C2)Br.Cl

Computed by PubChem (NCBI)