Products 1909308-98-0
CAS 1909308-98-0 is the registry number for 1-(2-Bromo-4-methylphenyl)cyclohexan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-bromo-4-methylphenyl)cyclohexan-1-amine;hydrochloride (CAS 1909308-98-0) is a chemical compound with the molecular formula C13H19BrClN and a molecular weight of 304.65 g/mol. IUPAC name: 1-(2-bromo-4-methylphenyl)cyclohexan-1-amine;hydrochloride. InChIKey: HLLCIVBJFPXMEG-UHFFFAOYSA-N.
| Molecular formula | C13H19BrClN |
|---|---|
| Molecular weight | 304.65 g/mol |
| IUPAC name | 1-(2-bromo-4-methylphenyl)cyclohexan-1-amine;hydrochloride |
| InChIKey | HLLCIVBJFPXMEG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2(CCCCC2)N)Br.Cl |
Computed by PubChem (NCBI)