Products 115846-24-7
CAS 115846-24-7 is the registry number for Lys-Ala-pNA, 99.83%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg, 5 mg.
(2S)-2,6-diamino-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]hexanamide (CAS 115846-24-7) is a chemical compound with the molecular formula C15H23N5O4 and a molecular weight of 337.37 g/mol. IUPAC name: (2S)-2,6-diamino-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]hexanamide. InChIKey: WKTQIBKMCKFCJE-GWCFXTLKSA-N.
| Molecular formula | C15H23N5O4 |
|---|---|
| Molecular weight | 337.37 g/mol |
| IUPAC name | (2S)-2,6-diamino-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]hexanamide |
| InChIKey | WKTQIBKMCKFCJE-GWCFXTLKSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)[C@H](CCCCN)N |
Computed by PubChem (NCBI)