Products 115846-96-3
CAS 115846-96-3 is the registry number for (1E,4E)-1-Phenyl-5-(p-tolyl)penta-1,4-dien-3-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
(1E,4E)-1-(4-methylphenyl)-5-phenylpenta-1,4-dien-3-one (CAS 115846-96-3) is a chemical compound with the molecular formula C18H16O and a molecular weight of 248.3 g/mol. IUPAC name: (1E,4E)-1-(4-methylphenyl)-5-phenylpenta-1,4-dien-3-one. InChIKey: DBDJWKCEIXOUDX-PHEQNACWSA-N.
| Molecular formula | C18H16O |
|---|---|
| Molecular weight | 248.3 g/mol |
| IUPAC name | (1E,4E)-1-(4-methylphenyl)-5-phenylpenta-1,4-dien-3-one |
| InChIKey | DBDJWKCEIXOUDX-PHEQNACWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)