CAS 137233-89-7 is the registry number for 1,2a,3,6,7,8-Hexahydro-cyclopenta(cd)pyren-4(2H)-one. Offered by: TRC. Available pack sizes: 100mg.
Pentacyclo[12.3.1.04,17.07,16.010,15]octadeca-1(17),7(16),8,10(15),14(18)-pentaen-2-one (CAS 137233-89-7) is a chemical compound with the molecular formula C18H16O and a molecular weight of 248.3 g/mol. IUPAC name: pentacyclo[12.3.1.04,17.07,16.010,15]octadeca-1(17),7(16),8,10(15),14(18)-pentaen-2-one. InChIKey: BZZLGVYNURCMGX-UHFFFAOYSA-N.
| Molecular formula | C18H16O |
|---|---|
| Molecular weight | 248.3 g/mol |
| IUPAC name | pentacyclo[12.3.1.04,17.07,16.010,15]octadeca-1(17),7(16),8,10(15),14(18)-pentaen-2-one |
| InChIKey | BZZLGVYNURCMGX-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC4=C5C3=C(CCC5CC4=O)C=C2)C1 |
Computed by PubChem (NCBI)