Products 1158487-38-7
CAS 1158487-38-7 appears in our catalog under these names: 5-[(Diethylamino)methyl]-2-methyl-3-furoic acid hydrochloride, 95%, 5-((Diethylamino)methyl)-2-methyl-3-furoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(diethylaminomethyl)-2-methylfuran-3-carboxylic acid;hydrochloride (CAS 1158487-38-7) is a chemical compound with the molecular formula C11H18ClNO3 and a molecular weight of 247.72 g/mol. IUPAC name: 5-(diethylaminomethyl)-2-methylfuran-3-carboxylic acid;hydrochloride. InChIKey: IGRYXWXFRJUXMP-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO3 |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 5-(diethylaminomethyl)-2-methylfuran-3-carboxylic acid;hydrochloride |
| InChIKey | IGRYXWXFRJUXMP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1=CC(=C(O1)C)C(=O)O.Cl |
Computed by PubChem (NCBI)