CAS 5984-95-2 appears in our catalog under these names: (-)-Isoproterenol Hydrochloride, (–)–Isoproterenol hydrochloride, (-)-Isoproterenol (hydrochloride), 99.97%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 5mg, 250mg, 500mg, 1000mg, 5000mg.
4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol;hydrochloride (CAS 5984-95-2) is a chemical compound with the molecular formula C11H18ClNO3 and a molecular weight of 247.72 g/mol. IUPAC name: 4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol;hydrochloride. InChIKey: IROWCYIEJAOFOW-MERQFXBCSA-N.
| Molecular formula | C11H18ClNO3 |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol;hydrochloride |
| InChIKey | IROWCYIEJAOFOW-MERQFXBCSA-N |
| SMILES | CC(C)NC[C@@H](C1=CC(=C(C=C1)O)O)O.Cl |
Computed by PubChem (NCBI)