Products 1158745-53-9
CAS 1158745-53-9 appears in our catalog under these names: 1-Boc-5-amino-3,3-dimethylindoline, 95%, 1-Boc-5-Amino-3,3-dimethylindoline, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg.
Tert-butyl 5-amino-3,3-dimethyl-2H-indole-1-carboxylate (CAS 1158745-53-9) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl 5-amino-3,3-dimethyl-2H-indole-1-carboxylate. InChIKey: JGZBEJFXXUVMNV-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl 5-amino-3,3-dimethyl-2H-indole-1-carboxylate |
| InChIKey | JGZBEJFXXUVMNV-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C1C=C(C=C2)N)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)