Products 1158763-52-0

CAS 1158763-52-0 is the registry number for 5-(2-Trifluoromethylphenyl)picolinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-[2-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid (CAS 1158763-52-0) is a chemical compound with the molecular formula C13H8F3NO2 and a molecular weight of 267.20 g/mol. IUPAC name: 5-[2-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid. InChIKey: DNOFIVFIIQGFPD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8F3NO2
Molecular weight267.20 g/mol
IUPAC name5-[2-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid
InChIKeyDNOFIVFIIQGFPD-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CN=C(C=C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)