CAS 924817-68-5 appears in our catalog under these names: 6-(4-Trifluoromethylphenyl)picolinic acid, 96%, 6-(4-(Trifluoromethyl)phenyl)picolinic acid, 95%, 6–(4–(Trifluoromethyl)phenyl)picolinic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
6-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid (CAS 924817-68-5) is a chemical compound with the molecular formula C13H8F3NO2 and a molecular weight of 267.20 g/mol. IUPAC name: 6-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid. InChIKey: JBAJBPRCHPGONU-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO2 |
|---|---|
| Molecular weight | 267.20 g/mol |
| IUPAC name | 6-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
| InChIKey | JBAJBPRCHPGONU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)