CAS 1159-15-5 appears in our catalog under these names: Tos–Arg–OH, Nalpha-Tosyl-L-arginine, Tos-Arg-OH 98%, Tos-Arg-OH, 98%, 98%, Tosyl-L-arginine, 99.29%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 500g, 1g, 5g, 10g, 25g, 25 g, 100 g.
(2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoic acid (CAS 1159-15-5) is a chemical compound with the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoic acid. InChIKey: KFNRNFXZFIRNEO-NSHDSACASA-N.
| Molecular formula | C13H20N4O4S |
|---|---|
| Molecular weight | 328.39 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoic acid |
| InChIKey | KFNRNFXZFIRNEO-NSHDSACASA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)