CAS 26647-58-5 is the registry number for H-DL-Arg(Tos)-OH, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]pentanoic acid (CAS 26647-58-5) is a chemical compound with the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. IUPAC name: 2-amino-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]pentanoic acid. InChIKey: SLTWQHUEZWYAOI-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4S |
|---|---|
| Molecular weight | 328.39 g/mol |
| IUPAC name | 2-amino-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]pentanoic acid |
| InChIKey | SLTWQHUEZWYAOI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=NCCCC(C(=O)O)N)N |
Computed by PubChem (NCBI)