CAS 115913-30-9 appears in our catalog under these names: 1,1'-(Bicyclo(1.1.1)pentane-1,3-diyl)diethanone, 1,1'-(Bicyclo[1.1.1]pentane-1,3-diyl)diethanone, 95%, 95%, 1,1'-(BICYCLO[1.1.1]PENTANE-1,3-DIYL)DIETHANONE, 98%, 1,1'-(Bicyclo[1.1.1]pentane-1,3-diyl)diethanone, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 10g, 100mg, 250mg, 1g, 5g, 100g, 500mg.
1-(3-acetyl-1-bicyclo[1.1.1]pentanyl)ethanone (CAS 115913-30-9) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: 1-(3-acetyl-1-bicyclo[1.1.1]pentanyl)ethanone. InChIKey: VBZKYGFCGJCPCT-UHFFFAOYSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | 1-(3-acetyl-1-bicyclo[1.1.1]pentanyl)ethanone |
| InChIKey | VBZKYGFCGJCPCT-UHFFFAOYSA-N |
| SMILES | CC(=O)C12CC(C1)(C2)C(=O)C |
Computed by PubChem (NCBI)