CAS 1159193-97-1 appears in our catalog under these names: MK-0686/ 99.56% (existing batch purity), (Rac)-MK 0686. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, Get quote.
Methyl 2-chloro-6-[3-fluoro-4-[1-[[1-[(2,2,2-trifluoroacetyl)amino]cyclopropanecarbonyl]amino]ethyl]phenyl]benzoate (CAS 1159193-97-1) is a chemical compound with the molecular formula C22H19ClF4N2O4 and a molecular weight of 486.8 g/mol. IUPAC name: methyl 2-chloro-6-[3-fluoro-4-[1-[[1-[(2,2,2-trifluoroacetyl)amino]cyclopropanecarbonyl]amino]ethyl]phenyl]benzoate. InChIKey: WZZIQHIQMWJNLU-UHFFFAOYSA-N.
| Molecular formula | C22H19ClF4N2O4 |
|---|---|
| Molecular weight | 486.8 g/mol |
| IUPAC name | methyl 2-chloro-6-[3-fluoro-4-[1-[[1-[(2,2,2-trifluoroacetyl)amino]cyclopropanecarbonyl]amino]ethyl]phenyl]benzoate |
| InChIKey | WZZIQHIQMWJNLU-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)C2=C(C(=CC=C2)Cl)C(=O)OC)F)NC(=O)C3(CC3)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)