CAS 1159265-95-8 appears in our catalog under these names: 2-Deoxy-2-fluoro-β-D-glucopyranosyl azide, 2-Deoxy-2-fluoro-β-D-glucopyranosyl azide. Offered by: Biosynth, Chemat. Available pack sizes: 10mg, 5mg, 100mg, 250mg, 25mg, 50mg.
(2R,3S,4S,5R,6R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol (CAS 1159265-95-8) is a chemical compound with the molecular formula C6H10FN3O4 and a molecular weight of 207.16 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol. InChIKey: USWPZYOMDAIBIH-QZABAPFNSA-N.
| Molecular formula | C6H10FN3O4 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol |
| InChIKey | USWPZYOMDAIBIH-QZABAPFNSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)N=[N+]=[N-])F)O)O)O |
Computed by PubChem (NCBI)