CAS 1258940-80-5 is the registry number for 2-Deoxy-2-fluoro-b-D-mannopyranosyl azide. Offered by: Biosynth. Available pack sizes: 250mg, 100mg.
(3S,4R,6R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol (CAS 1258940-80-5) is a chemical compound with the molecular formula C6H10FN3O4 and a molecular weight of 207.16 g/mol. IUPAC name: (3S,4R,6R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol. InChIKey: USWPZYOMDAIBIH-RKFISERESA-N.
| Molecular formula | C6H10FN3O4 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | (3S,4R,6R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol |
| InChIKey | USWPZYOMDAIBIH-RKFISERESA-N |
| SMILES | C(C1[C@H]([C@H](C([C@@H](O1)N=[N+]=[N-])F)O)O)O |
Computed by PubChem (NCBI)