Products 1159602-54-6

CAS 1159602-54-6 is the registry number for 3-(2,5-Difluoro-phenyl)-5-methyl-isoxazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 1159602-54-6) is a chemical compound with the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. IUPAC name: ethyl 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: VJDOQBRRFNUEFT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11F2NO3
Molecular weight267.23 g/mol
IUPAC nameethyl 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate
InChIKeyVJDOQBRRFNUEFT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(ON=C1C2=C(C=CC(=C2)F)F)C

Computed by PubChem (NCBI)