CAS 1159602-54-6 is the registry number for 3-(2,5-Difluoro-phenyl)-5-methyl-isoxazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 1159602-54-6) is a chemical compound with the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. IUPAC name: ethyl 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: VJDOQBRRFNUEFT-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO3 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | ethyl 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | VJDOQBRRFNUEFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1C2=C(C=CC(=C2)F)F)C |
Computed by PubChem (NCBI)