Products 2324749-21-3
CAS 2324749-21-3 is the registry number for Ethyl 2-(2,6-difluorophenyl)-5-methyloxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2,6-difluorophenyl)-5-methyl-1,3-oxazole-4-carboxylate (CAS 2324749-21-3) is a chemical compound with the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. IUPAC name: ethyl 2-(2,6-difluorophenyl)-5-methyl-1,3-oxazole-4-carboxylate. InChIKey: ZPVRHVJZSIEFCE-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO3 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | ethyl 2-(2,6-difluorophenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| InChIKey | ZPVRHVJZSIEFCE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=C(C=CC=C2F)F)C |
Computed by PubChem (NCBI)