CAS 1159607-48-3 is the registry number for 3-Bromo-4-phenoxyaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-4-phenoxyaniline (CAS 1159607-48-3) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 3-bromo-4-phenoxyaniline. InChIKey: POFTVCQGIZTAMC-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 3-bromo-4-phenoxyaniline |
| InChIKey | POFTVCQGIZTAMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)N)Br |
Computed by PubChem (NCBI)