CAS 1159733-28-4 is the registry number for tert-Butyl N-(1-carbamothioylcyclopropyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-(1-carbamothioylcyclopropyl)carbamate (CAS 1159733-28-4) is a chemical compound with the molecular formula C9H16N2O2S and a molecular weight of 216.30 g/mol. IUPAC name: tert-butyl N-(1-carbamothioylcyclopropyl)carbamate. InChIKey: GXULZLWFLXCUBB-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O2S |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | tert-butyl N-(1-carbamothioylcyclopropyl)carbamate |
| InChIKey | GXULZLWFLXCUBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C(=S)N |
Computed by PubChem (NCBI)