CAS 1594679-01-2 is the registry number for 4-(Cyclopropyl(imino)methyl)-3-methylthiomorpholine 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopropyl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanimine (CAS 1594679-01-2) is a chemical compound with the molecular formula C9H16N2O2S and a molecular weight of 216.30 g/mol. IUPAC name: cyclopropyl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanimine. InChIKey: MIEYHKCJSUCHJB-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O2S |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | cyclopropyl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanimine |
| InChIKey | MIEYHKCJSUCHJB-UHFFFAOYSA-N |
| SMILES | CC1CS(=O)(=O)CCN1C(=N)C2CC2 |
Computed by PubChem (NCBI)