CAS 1159814-31-9 is the registry number for 5-Bromo-2-(3-fluorophenyl)-1,3-thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-2-(3-fluorophenyl)-1,3-thiazole (CAS 1159814-31-9) is a chemical compound with the molecular formula C9H5BrFNS and a molecular weight of 258.11 g/mol. IUPAC name: 5-bromo-2-(3-fluorophenyl)-1,3-thiazole. InChIKey: IEKUAMMKJANLGT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNS |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 5-bromo-2-(3-fluorophenyl)-1,3-thiazole |
| InChIKey | IEKUAMMKJANLGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC=C(S2)Br |
Computed by PubChem (NCBI)