CAS 1779815-15-4 is the registry number for 5-Bromo-3-(3-fluorophenyl)isothiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-3-(3-fluorophenyl)-1,2-thiazole (CAS 1779815-15-4) is a chemical compound with the molecular formula C9H5BrFNS and a molecular weight of 258.11 g/mol. IUPAC name: 5-bromo-3-(3-fluorophenyl)-1,2-thiazole. InChIKey: BQDXVFSJJBSQPZ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNS |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 5-bromo-3-(3-fluorophenyl)-1,2-thiazole |
| InChIKey | BQDXVFSJJBSQPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NSC(=C2)Br |
Computed by PubChem (NCBI)