CAS 1159816-25-7 is the registry number for 6-(Pyrimidin-5-yl)pyrazin-2-amine 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
6-pyrimidin-5-ylpyrazin-2-amine (CAS 1159816-25-7) is a chemical compound with the molecular formula C8H7N5 and a molecular weight of 173.17 g/mol. IUPAC name: 6-pyrimidin-5-ylpyrazin-2-amine. InChIKey: JCMHUSCHDSUEGY-UHFFFAOYSA-N.
| Molecular formula | C8H7N5 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 6-pyrimidin-5-ylpyrazin-2-amine |
| InChIKey | JCMHUSCHDSUEGY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=N1)C2=CN=CC(=N2)N |
Computed by PubChem (NCBI)