CAS 533930-18-6 appears in our catalog under these names: Di(pyrazin–2–yl)amine, Di(pyrazin-2-yl)amine 97%, Di(pyrazin-2-yl)amine, 98%, 98%, Di(pyrazin-2-yl)amine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
N-pyrazin-2-ylpyrazin-2-amine (CAS 533930-18-6) is a chemical compound with the molecular formula C8H7N5 and a molecular weight of 173.17 g/mol. IUPAC name: N-pyrazin-2-ylpyrazin-2-amine. InChIKey: NGUJZUZCTOZSMW-UHFFFAOYSA-N.
| Molecular formula | C8H7N5 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | N-pyrazin-2-ylpyrazin-2-amine |
| InChIKey | NGUJZUZCTOZSMW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)NC2=NC=CN=C2 |
Computed by PubChem (NCBI)