CAS 1159822-76-0 appears in our catalog under these names: 5-Benzyl-2,5-diaza-spiro[3.4]octane dihydrochloride, 95%, 5-Benzyl-2,5-diazaspiro(3.4)octane dihydrochloride, 97%, 5-Benzyl-2,5-diaza-spiro[3.4]octane DiHCl, 98%, 98%, 5-BENZYL-2,5-DIAZA-SPIRO[3.4]OCTANE 2HCL, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
5-benzyl-2,5-diazaspiro[3.4]octane;dihydrochloride (CAS 1159822-76-0) is a chemical compound with the molecular formula C13H20Cl2N2 and a molecular weight of 275.21 g/mol. IUPAC name: 5-benzyl-2,5-diazaspiro[3.4]octane;dihydrochloride. InChIKey: RACWBOYLAADTNQ-UHFFFAOYSA-N.
| Molecular formula | C13H20Cl2N2 |
|---|---|
| Molecular weight | 275.21 g/mol |
| IUPAC name | 5-benzyl-2,5-diazaspiro[3.4]octane;dihydrochloride |
| InChIKey | RACWBOYLAADTNQ-UHFFFAOYSA-N |
| SMILES | C1CC2(CNC2)N(C1)CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)