CAS 88185-31-3 is the registry number for 1-[(2E)-3-Phenylprop-2-en-1-yl]piperazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-[(E)-3-phenylprop-2-enyl]piperazine;dihydrochloride (CAS 88185-31-3) is a chemical compound with the molecular formula C13H20Cl2N2 and a molecular weight of 275.21 g/mol. IUPAC name: 1-[(E)-3-phenylprop-2-enyl]piperazine;dihydrochloride. InChIKey: PRCFTTDNUVTMRS-RDRKJGRWSA-N.
| Molecular formula | C13H20Cl2N2 |
|---|---|
| Molecular weight | 275.21 g/mol |
| IUPAC name | 1-[(E)-3-phenylprop-2-enyl]piperazine;dihydrochloride |
| InChIKey | PRCFTTDNUVTMRS-RDRKJGRWSA-N |
| SMILES | C1CN(CCN1)C/C=C/C2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)