CAS 1159823-84-3 appears in our catalog under these names: 9-Chloro-2,3,4,5-tetrahydro-1h-benzo[e][1,4]diazepine dihydrochloride, 95%, 9-Chloro-2,3,4,5-tetrahydro-1H-benzo(e)(1,4)diazepine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
9-chloro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine;dihydrochloride (CAS 1159823-84-3) is a chemical compound with the molecular formula C9H13Cl3N2 and a molecular weight of 255.6 g/mol. IUPAC name: 9-chloro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine;dihydrochloride. InChIKey: JLHZTGCPIGPAHU-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl3N2 |
|---|---|
| Molecular weight | 255.6 g/mol |
| IUPAC name | 9-chloro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine;dihydrochloride |
| InChIKey | JLHZTGCPIGPAHU-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(CN1)C=CC=C2Cl.Cl.Cl |
Computed by PubChem (NCBI)