Products 2512202-85-4
CAS 2512202-85-4 is the registry number for N1,N1-Dichloro-N4,N4,2-trimethylbenzene-1,4-diamine Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
1-N,1-N-dichloro-4-N,4-N,2-trimethylbenzene-1,4-diamine;hydrochloride (CAS 2512202-85-4) is a chemical compound with the molecular formula C9H13Cl3N2 and a molecular weight of 255.6 g/mol. IUPAC name: 1-N,1-N-dichloro-4-N,4-N,2-trimethylbenzene-1,4-diamine;hydrochloride. InChIKey: LBVQBZGKYWXSKZ-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl3N2 |
|---|---|
| Molecular weight | 255.6 g/mol |
| IUPAC name | 1-N,1-N-dichloro-4-N,4-N,2-trimethylbenzene-1,4-diamine;hydrochloride |
| InChIKey | LBVQBZGKYWXSKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N(C)C)N(Cl)Cl.Cl |
Computed by PubChem (NCBI)