Products 115994-31-5
CAS 115994-31-5 is the registry number for LY-228729. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4R)-4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide (CAS 115994-31-5) is a chemical compound with the molecular formula C18H25N3O and a molecular weight of 299.4 g/mol. IUPAC name: (4R)-4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide. InChIKey: YTOJFUORFUYGSV-ZDUSSCGKSA-N.
| Molecular formula | C18H25N3O |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (4R)-4-(dipropylamino)-1,3,4,5-tetrahydrobenzo[cd]indole-6-carboxamide |
| InChIKey | YTOJFUORFUYGSV-ZDUSSCGKSA-N |
| SMILES | CCCN(CCC)[C@H]1CC2=CNC3=C2C(=C(C=C3)C(=O)N)C1 |
Computed by PubChem (NCBI)