Products 1159976-55-2
CAS 1159976-55-2 is the registry number for 2-amino-1-(1-aza-2-(3-bromophenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-amino-3-[(3-bromophenyl)methylideneamino]but-2-enedinitrile (CAS 1159976-55-2) is a chemical compound with the molecular formula C11H7BrN4 and a molecular weight of 275.10 g/mol. IUPAC name: (Z)-2-amino-3-[(3-bromophenyl)methylideneamino]but-2-enedinitrile. InChIKey: XNWVKHOTLNWOOI-OOQWFJINSA-N.
| Molecular formula | C11H7BrN4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | (Z)-2-amino-3-[(3-bromophenyl)methylideneamino]but-2-enedinitrile |
| InChIKey | XNWVKHOTLNWOOI-OOQWFJINSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)