CAS 2411634-40-5 is the registry number for 1-(3-Bromophenyl)-1H-imidazo[4,5-b]pyrazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(3-bromophenyl)imidazo[4,5-b]pyrazine (CAS 2411634-40-5) is a chemical compound with the molecular formula C11H7BrN4 and a molecular weight of 275.10 g/mol. IUPAC name: 3-(3-bromophenyl)imidazo[4,5-b]pyrazine. InChIKey: MFEQMHYGQCBRFX-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 3-(3-bromophenyl)imidazo[4,5-b]pyrazine |
| InChIKey | MFEQMHYGQCBRFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=NC3=NC=CN=C32 |
Computed by PubChem (NCBI)