Products 1159976-65-4
CAS 1159976-65-4 is the registry number for 4-(4-(methoxyimino)indeno(2,3-d)pyrazol-3-yl)-1,2-dimethoxybenzene. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-3-(3,4-dimethoxyphenyl)-N-methoxy-1H-indeno[2,1-d]pyrazol-4-imine (CAS 1159976-65-4) is a chemical compound with the molecular formula C19H17N3O3 and a molecular weight of 335.4 g/mol. IUPAC name: (Z)-3-(3,4-dimethoxyphenyl)-N-methoxy-1H-indeno[2,1-d]pyrazol-4-imine. InChIKey: WUDHUMMKFFHXSC-QOCHGBHMSA-N.
| Molecular formula | C19H17N3O3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (Z)-3-(3,4-dimethoxyphenyl)-N-methoxy-1H-indeno[2,1-d]pyrazol-4-imine |
| InChIKey | WUDHUMMKFFHXSC-QOCHGBHMSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NNC3=C2/C(=N\OC)/C4=CC=CC=C43)OC |
Computed by PubChem (NCBI)