CAS 1159977-00-0 is the registry number for 5-Acetoxymethyl-2,3-dimethylpyridine N-oxide. Offered by: TRC. Available pack sizes: 250mg, 25mg.
(5,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methyl acetate (CAS 1159977-00-0) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (5,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methyl acetate. InChIKey: CSNXGEFOFOGJOZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (5,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methyl acetate |
| InChIKey | CSNXGEFOFOGJOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C[N+](=C1C)[O-])COC(=O)C |
Computed by PubChem (NCBI)