CAS 1159977-21-5 is the registry number for 5-(3-Chloropropyl)-10,11-dihydro-2-hydroxy-5H-dibenz(b,f)azepine. Offered by: TRC. Available pack sizes: 1mg, 2mg, 5mg.
11-(3-chloropropyl)-5,6-dihydrobenzo[b][1]benzazepin-3-ol (CAS 1159977-21-5) is a chemical compound with the molecular formula C17H18ClNO and a molecular weight of 287.8 g/mol. IUPAC name: 11-(3-chloropropyl)-5,6-dihydrobenzo[b][1]benzazepin-3-ol. InChIKey: TWCKEJUUFQONEN-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO |
|---|---|
| Molecular weight | 287.8 g/mol |
| IUPAC name | 11-(3-chloropropyl)-5,6-dihydrobenzo[b][1]benzazepin-3-ol |
| InChIKey | TWCKEJUUFQONEN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)O)N(C3=CC=CC=C31)CCCCl |
Computed by PubChem (NCBI)