CAS 1688731-74-9 appears in our catalog under these names: Asenapine Impurity 17, Asenapine Phenol. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-chloro-2-[(3S,4S)-1-methyl-4-phenylpyrrolidin-3-yl]phenol (CAS 1688731-74-9) is a chemical compound with the molecular formula C17H18ClNO and a molecular weight of 287.8 g/mol. IUPAC name: 4-chloro-2-[(3S,4S)-1-methyl-4-phenylpyrrolidin-3-yl]phenol. InChIKey: KGBQFNHXVTXWQB-HZPDHXFCSA-N.
| Molecular formula | C17H18ClNO |
|---|---|
| Molecular weight | 287.8 g/mol |
| IUPAC name | 4-chloro-2-[(3S,4S)-1-methyl-4-phenylpyrrolidin-3-yl]phenol |
| InChIKey | KGBQFNHXVTXWQB-HZPDHXFCSA-N |
| SMILES | CN1C[C@@H]([C@H](C1)C2=C(C=CC(=C2)Cl)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)