CAS 1159977-23-7 appears in our catalog under these names: Doxorubicin Impurity 7, Doxorubicin Impurity 17, 7,8,9,10-Dehydro Doxorubicinone (~70%), 7,8,9,10-Dehydro doxorubicinone. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg.
1,6,11-trihydroxy-3-(2-hydroxyacetyl)-10-methoxytetracene-5,12-dione (CAS 1159977-23-7) is a chemical compound with the molecular formula C21H14O8 and a molecular weight of 394.3 g/mol. IUPAC name: 1,6,11-trihydroxy-3-(2-hydroxyacetyl)-10-methoxytetracene-5,12-dione. InChIKey: AAIXWCJEVLBUIC-UHFFFAOYSA-N.
| Molecular formula | C21H14O8 |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | 1,6,11-trihydroxy-3-(2-hydroxyacetyl)-10-methoxytetracene-5,12-dione |
| InChIKey | AAIXWCJEVLBUIC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=C3C(=C2O)C(=O)C4=C(C3=O)C(=CC(=C4)C(=O)CO)O)O |
Computed by PubChem (NCBI)