CAS 914919-19-0 is the registry number for 4,4'-((5-Carboxy-1,3-phenylene)bis(oxy))dibenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,5-bis(4-carboxyphenoxy)benzoic acid (CAS 914919-19-0) is a chemical compound with the molecular formula C21H14O8 and a molecular weight of 394.3 g/mol. IUPAC name: 3,5-bis(4-carboxyphenoxy)benzoic acid. InChIKey: VWYXRUQXOGUVSG-UHFFFAOYSA-N.
| Molecular formula | C21H14O8 |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | 3,5-bis(4-carboxyphenoxy)benzoic acid |
| InChIKey | VWYXRUQXOGUVSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC(=CC(=C2)C(=O)O)OC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)