CAS 1159977-40-8 is the registry number for 5-Hydroxymethyl-4-methoxy-2,3-dimethylpyridine N-oxide. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(4-methoxy-5,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methanol (CAS 1159977-40-8) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: (4-methoxy-5,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methanol. InChIKey: UGPLRGVWLVUBSL-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (4-methoxy-5,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methanol |
| InChIKey | UGPLRGVWLVUBSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C[N+](=C1C)[O-])CO)OC |
Computed by PubChem (NCBI)