CAS 1159977-56-6 appears in our catalog under these names: Ziprasidone EP Impurity B, Ziprasidone EP Impurity B (Ziprasidone USP Related Compound B), Ziprasidone Impurity 2(Ziprasidone EP Impurity B), 3-Oxo Ziprasidone. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1H-indole-2,3-dione (CAS 1159977-56-6) is a chemical compound with the molecular formula C21H19ClN4O2S and a molecular weight of 426.9 g/mol. IUPAC name: 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1H-indole-2,3-dione. InChIKey: VWHQRPYTDLERQO-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN4O2S |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1H-indole-2,3-dione |
| InChIKey | VWHQRPYTDLERQO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC2=CC3=C(C=C2Cl)NC(=O)C3=O)C4=NSC5=CC=CC=C54 |
Computed by PubChem (NCBI)