CAS 884305-07-1 appears in our catalog under these names: Keto Ziprasidone, Keto Ziprasidone, Keto Ziprasidone, 98.96%. Offered by: GLPBio, Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: 1mg, on request, 5mg, 25mg, 10mg, 50mg, 5 mg, 10 mg.
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]acetyl]-6-chloro-1,3-dihydroindol-2-one (CAS 884305-07-1) is a chemical compound with the molecular formula C21H19ClN4O2S and a molecular weight of 426.9 g/mol. IUPAC name: 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]acetyl]-6-chloro-1,3-dihydroindol-2-one. InChIKey: SJOODKMSLMNGEY-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN4O2S |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]acetyl]-6-chloro-1,3-dihydroindol-2-one |
| InChIKey | SJOODKMSLMNGEY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)C2=C(C=C3C(=C2)CC(=O)N3)Cl)C4=NSC5=CC=CC=C54 |
Computed by PubChem (NCBI)