CAS 1160247-30-2 appears in our catalog under these names: tert-Butyl 5-bromo-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 95%, Tert-Butyl 5-Bromo-3-Oxo-2,3-Dihydrospiro(Indene-1,4-Piperidine)-1-Carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
Tert-butyl 5-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (CAS 1160247-30-2) is a chemical compound with the molecular formula C18H22BrNO3 and a molecular weight of 380.3 g/mol. IUPAC name: tert-butyl 5-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate. InChIKey: ZYHGCPHMBLZTFS-UHFFFAOYSA-N.
| Molecular formula | C18H22BrNO3 |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | ZYHGCPHMBLZTFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)