CAS 1160247-52-8 is the registry number for tert-Butyl 7-bromo-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (CAS 1160247-52-8) is a chemical compound with the molecular formula C18H22BrNO3 and a molecular weight of 380.3 g/mol. IUPAC name: tert-butyl 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate. InChIKey: BTKGZHPVSDECPY-UHFFFAOYSA-N.
| Molecular formula | C18H22BrNO3 |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | tert-butyl 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | BTKGZHPVSDECPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C2C(=CC=C3)Br |
Computed by PubChem (NCBI)