CAS 1160247-32-4 is the registry number for tert-Butyl 6-chloro-2,3-dihydrospiro(indene-1,4'-piperidine)-1'-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Tert-butyl 5-chlorospiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate (CAS 1160247-32-4) is a chemical compound with the molecular formula C18H24ClNO2 and a molecular weight of 321.8 g/mol. IUPAC name: tert-butyl 5-chlorospiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate. InChIKey: VYXHNAJIDSFZGU-UHFFFAOYSA-N.
| Molecular formula | C18H24ClNO2 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | tert-butyl 5-chlorospiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate |
| InChIKey | VYXHNAJIDSFZGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC3=C2C=C(C=C3)Cl)CC1 |
Computed by PubChem (NCBI)