CAS 6027-00-5 is the registry number for Medrylamine Hydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
2-[(4-methoxyphenyl)-phenylmethoxy]ethyl-dimethylazanium chloride (CAS 6027-00-5) is a chemical compound with the molecular formula C18H24ClNO2 and a molecular weight of 321.8 g/mol. IUPAC name: 2-[(4-methoxyphenyl)-phenylmethoxy]ethyl-dimethylazanium chloride. InChIKey: ZLOMYDCFJHNHGM-UHFFFAOYSA-N.
| Molecular formula | C18H24ClNO2 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)-phenylmethoxy]ethyl-dimethylazanium chloride |
| InChIKey | ZLOMYDCFJHNHGM-UHFFFAOYSA-N |
| SMILES | C[NH+](C)CCOC(C1=CC=CC=C1)C2=CC=C(C=C2)OC.[Cl-] |
Computed by PubChem (NCBI)