Products 2415204-31-6
CAS 2415204-31-6 is the registry number for tert-Butyl 1-(4-bromophenyl)-6-azaspiro[2.5]octane-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-(4-bromophenyl)-6-azaspiro[2.5]octane-6-carboxylate (CAS 2415204-31-6) is a chemical compound with the molecular formula C18H24BrNO2 and a molecular weight of 366.3 g/mol. IUPAC name: tert-butyl 2-(4-bromophenyl)-6-azaspiro[2.5]octane-6-carboxylate. InChIKey: ULBLEEIHHSBAGH-UHFFFAOYSA-N.
| Molecular formula | C18H24BrNO2 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | tert-butyl 2-(4-bromophenyl)-6-azaspiro[2.5]octane-6-carboxylate |
| InChIKey | ULBLEEIHHSBAGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC2C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)