CAS 1160247-72-2 appears in our catalog under these names: tert-Butyl 4-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate, 95%, tert–Butyl 4–bromo–1,2–dihydrospiro(indole–3,4'–piperidine)–1'–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
Tert-butyl 4-bromospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate (CAS 1160247-72-2) is a chemical compound with the molecular formula C17H23BrN2O2 and a molecular weight of 367.3 g/mol. IUPAC name: tert-butyl 4-bromospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate. InChIKey: HLMMEAFIUWRKDO-UHFFFAOYSA-N.
| Molecular formula | C17H23BrN2O2 |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | tert-butyl 4-bromospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | HLMMEAFIUWRKDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNC3=C2C(=CC=C3)Br |
Computed by PubChem (NCBI)