CAS 1609408-96-9 is the registry number for N-(4-Nitrobenzyl)-1-adamantanamine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(4-nitrophenyl)methyl]adamantan-1-amine;hydrobromide (CAS 1609408-96-9) is a chemical compound with the molecular formula C17H23BrN2O2 and a molecular weight of 367.3 g/mol. IUPAC name: N-[(4-nitrophenyl)methyl]adamantan-1-amine;hydrobromide. InChIKey: CBNXMHGBRQKENW-UHFFFAOYSA-N.
| Molecular formula | C17H23BrN2O2 |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | N-[(4-nitrophenyl)methyl]adamantan-1-amine;hydrobromide |
| InChIKey | CBNXMHGBRQKENW-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NCC4=CC=C(C=C4)[N+](=O)[O-].Br |
Computed by PubChem (NCBI)